hexyl salicylate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

hexyl 2-hydroxybenzoate; n-hexyl 2-hydroxybenzoate; hexyl salicylate
CAS RN:[6259-76-3]
Formula:C13H18O3; 222.28 g/mol
InChiKey:DUKPKQFHJQGTGU-UHFFFAOYSA-N
SMILES:CCCCCCOC(=O)c1ccccc1O
Molecular structure of hexyl salicylate
Density:1.040 g/mL
Molar volume:213.7 mL/mol
Boiling point:290 °C

Isomers

2-butoxyethyl benzoate
Molecular structure of 2-butoxyethyl benzoate
ethyl 2-methyl-2-(4-methylphenoxy)propanoate
Molecular structure of ethyl 2-methyl-2-(4-methylphenoxy)propanoate
hexyl 4-hydroxybenzoate
Molecular structure of hexyl 4-hydroxybenzoate
4-hexyloxybenzoic acid
Molecular structure of 4-hexyloxybenzoic acid
hexyl salicylate
Molecular structure of hexyl salicylate
2-hydroxy-3,5-diisopropylbenzoic acid
Molecular structure of 2-hydroxy-3,5-diisopropylbenzoic acid
8α-methyl-6-oxo-1,2,3,4,6,7,8,8α-octahydronaphthalen-1-yl acetate
Molecular structure of 8a-methyl-6-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl acetate
  ::